C11H19BrN4O — CID 80813928
5-bromo-2-N-ethyl-4-N-(4-methoxybutyl)pyrimidine-2,4-diamine (PubChem CID 80813928) has the molecular formula C11H19BrN4O and a molecular weight of 303.20 g/mol. Its IUPAC name is 5-bromo-2-N-ethyl-4-N-(4-methoxybutyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-ethyl-4-N-(4-methoxybutyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80813928 |
| Molecular Formula | C11H19BrN4O |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5-bromo-2-N-ethyl-4-N-(4-methoxybutyl)pyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(Br)c(NCCCCOC)n1 |
| InChI | InChI=1S/C11H19BrN4O/c1-3-13-11-15-8-9(12)10(16-11)14-6-4-5-7-17-2/h8H,3-7H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | RCPAJTDVJUWOJX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|