C12H20BrN3O3 — CID 103408326
5-bromo-N-ethyl-4-[3-(2-methoxyethoxy)propoxy]pyrimidin-2-amine (PubChem CID 103408326) has the molecular formula C12H20BrN3O3 and a molecular weight of 334.21 g/mol. Its IUPAC name is 5-bromo-N-ethyl-4-[3-(2-methoxyethoxy)propoxy]pyrimidin-2-amine.
| Compound Name | 5-bromo-N-ethyl-4-[3-(2-methoxyethoxy)propoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103408326 |
| Molecular Formula | C12H20BrN3O3 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 5-bromo-N-ethyl-4-[3-(2-methoxyethoxy)propoxy]pyrimidin-2-amine |
| SMILES | CCNc1ncc(Br)c(OCCCOCCOC)n1 |
| InChI | InChI=1S/C12H20BrN3O3/c1-3-14-12-15-9-10(13)11(16-12)19-6-4-5-18-8-7-17-2/h9H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | DXTOXYSQBSJRAX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|