C8H12BrN3O2 — CID 103726573
5-bromo-4-methoxy-N-(2-methoxyethyl)pyrimidin-2-amine (PubChem CID 103726573) has the molecular formula C8H12BrN3O2 and a molecular weight of 262.11 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N-(2-methoxyethyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-methoxy-N-(2-methoxyethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 103726573 |
| Molecular Formula | C8H12BrN3O2 |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 5-bromo-4-methoxy-N-(2-methoxyethyl)pyrimidin-2-amine |
| SMILES | COCCNc1ncc(Br)c(OC)n1 |
| InChI | InChI=1S/C8H12BrN3O2/c1-13-4-3-10-8-11-5-6(9)7(12-8)14-2/h5H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | ONYLCOHBQHUYJB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|