C10H16BrN3OS — CID 106997923
5-bromo-4-methoxy-N-(3-methylsulfanylbutyl)pyrimidin-2-amine (PubChem CID 106997923) has the molecular formula C10H16BrN3OS and a molecular weight of 306.23 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N-(3-methylsulfanylbutyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-methoxy-N-(3-methylsulfanylbutyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106997923 |
| Molecular Formula | C10H16BrN3OS |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 5-bromo-4-methoxy-N-(3-methylsulfanylbutyl)pyrimidin-2-amine |
| SMILES | COc1nc(NCCC(C)SC)ncc1Br |
| InChI | InChI=1S/C10H16BrN3OS/c1-7(16-3)4-5-12-10-13-6-8(11)9(14-10)15-2/h6-7H,4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | XACBXEYBEWVCNS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |