C9H14BrN3O2S — CID 103846782
5-bromo-4-methoxy-N-(2-methylsulfinylpropyl)pyrimidin-2-amine (PubChem CID 103846782) has the molecular formula C9H14BrN3O2S and a molecular weight of 308.20 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N-(2-methylsulfinylpropyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-methoxy-N-(2-methylsulfinylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 103846782 |
| Molecular Formula | C9H14BrN3O2S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 5-bromo-4-methoxy-N-(2-methylsulfinylpropyl)pyrimidin-2-amine |
| SMILES | COc1nc(NCC(C)S(C)=O)ncc1Br |
| InChI | InChI=1S/C9H14BrN3O2S/c1-6(16(3)14)4-11-9-12-5-7(10)8(13-9)15-2/h5-6H,4H2,1-3H3,(H,11,12,13) |
| InChIKey | PFGFVTOYQBNTOK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |