C5H5BrIN3O — CID 147407713
5-bromo-N-iodo-4-methoxypyrimidin-2-amine (PubChem CID 147407713) has the molecular formula C5H5BrIN3O and a molecular weight of 329.92 g/mol. Its IUPAC name is 5-bromo-N-iodo-4-methoxypyrimidin-2-amine.
| Compound Name | 5-bromo-N-iodo-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 147407713 |
| Molecular Formula | C5H5BrIN3O |
| Molecular Weight | 329.92 g/mol |
| Exact Mass | 328.87 |
| IUPAC Name | 5-bromo-N-iodo-4-methoxypyrimidin-2-amine |
| SMILES | COc1nc(NI)ncc1Br |
| InChI | InChI=1S/C5H5BrIN3O/c1-11-4-3(6)2-8-5(9-4)10-7/h2H,1H3,(H,8,9,10) |
| InChIKey | DPZKDTORQRYDEQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.92 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|