C11H6BrF4N3O — CID 107645852
5-bromo-4-methoxy-N-(2,3,5,6-tetrafluorophenyl)pyrimidin-2-amine (PubChem CID 107645852) has the molecular formula C11H6BrF4N3O and a molecular weight of 352.09 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N-(2,3,5,6-tetrafluorophenyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-methoxy-N-(2,3,5,6-tetrafluorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 107645852 |
| Molecular Formula | C11H6BrF4N3O |
| Molecular Weight | 352.09 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 5-bromo-4-methoxy-N-(2,3,5,6-tetrafluorophenyl)pyrimidin-2-amine |
| SMILES | COc1nc(Nc2c(F)c(F)cc(F)c2F)ncc1Br |
| InChI | InChI=1S/C11H6BrF4N3O/c1-20-10-4(12)3-17-11(19-10)18-9-7(15)5(13)2-6(14)8(9)16/h2-3H,1H3,(H,17,18,19) |
| InChIKey | RDYRYEKPOLXULY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.09 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|