C10H15BrN4O — CID 106998101
N'-(5-bromo-4-methoxypyrimidin-2-yl)-N-cyclopropylethane-1,2-diamine (PubChem CID 106998101) has the molecular formula C10H15BrN4O and a molecular weight of 287.16 g/mol. Its IUPAC name is N'-(5-bromo-4-methoxypyrimidin-2-yl)-N-cyclopropylethane-1,2-diamine.
| Compound Name | N'-(5-bromo-4-methoxypyrimidin-2-yl)-N-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 106998101 |
| Molecular Formula | C10H15BrN4O |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | N'-(5-bromo-4-methoxypyrimidin-2-yl)-N-cyclopropylethane-1,2-diamine |
| SMILES | COc1nc(NCCNC2CC2)ncc1Br |
| InChI | InChI=1S/C10H15BrN4O/c1-16-9-8(11)6-14-10(15-9)13-5-4-12-7-2-3-7/h6-7,12H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | PXCXUNSOFBNFGT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|