C12H19BrClN3O — CID 107156206
5-bromo-N-(2-chloro-4,4-dimethylpentyl)-4-methoxypyrimidin-2-amine (PubChem CID 107156206) has the molecular formula C12H19BrClN3O and a molecular weight of 336.66 g/mol. Its IUPAC name is 5-bromo-N-(2-chloro-4,4-dimethylpentyl)-4-methoxypyrimidin-2-amine.
| Compound Name | 5-bromo-N-(2-chloro-4,4-dimethylpentyl)-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 107156206 |
| Molecular Formula | C12H19BrClN3O |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 5-bromo-N-(2-chloro-4,4-dimethylpentyl)-4-methoxypyrimidin-2-amine |
| SMILES | COc1nc(NCC(Cl)CC(C)(C)C)ncc1Br |
| InChI | InChI=1S/C12H19BrClN3O/c1-12(2,3)5-8(14)6-15-11-16-7-9(13)10(17-11)18-4/h7-8H,5-6H2,1-4H3,(H,15,16,17) |
| InChIKey | MVOXVKXMKKKQKH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|