C8H13BrN4O3S — CID 106337859
2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]-N-methylethanesulfonamide (PubChem CID 106337859) has the molecular formula C8H13BrN4O3S and a molecular weight of 325.19 g/mol. Its IUPAC name is 2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106337859 |
| Molecular Formula | C8H13BrN4O3S |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1ncc(Br)c(OC)n1 |
| InChI | InChI=1S/C8H13BrN4O3S/c1-10-17(14,15)4-3-11-8-12-5-6(9)7(13-8)16-2/h5,10H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | IXJQIRRVCGRMGW-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |