C7H11FN4O2S — CID 102675409
2-[(5-fluoropyrimidin-2-yl)amino]-N-methylethanesulfonamide (PubChem CID 102675409) has the molecular formula C7H11FN4O2S and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-[(5-fluoropyrimidin-2-yl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(5-fluoropyrimidin-2-yl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 102675409 |
| Molecular Formula | C7H11FN4O2S |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-[(5-fluoropyrimidin-2-yl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1ncc(F)cn1 |
| InChI | InChI=1S/C7H11FN4O2S/c1-9-15(13,14)3-2-10-7-11-4-6(8)5-12-7/h4-5,9H,2-3H2,1H3,(H,10,11,12) |
| InChIKey | HMIDGOGVVCSLKH-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |