C9H16N4O2S — CID 103858115
N-ethyl-2-[(5-methylpyrimidin-2-yl)amino]ethanesulfonamide (PubChem CID 103858115) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is N-ethyl-2-[(5-methylpyrimidin-2-yl)amino]ethanesulfonamide.
| Compound Name | N-ethyl-2-[(5-methylpyrimidin-2-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 103858115 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-ethyl-2-[(5-methylpyrimidin-2-yl)amino]ethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1ncc(C)cn1 |
| InChI | InChI=1S/C9H16N4O2S/c1-3-13-16(14,15)5-4-10-9-11-6-8(2)7-12-9/h6-7,13H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | GITLXGUNIAXYDL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |