C10H18BrN5O2S — CID 106343306
2-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]amino]-N-ethylethanesulfonamide (PubChem CID 106343306) has the molecular formula C10H18BrN5O2S and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106343306 |
| Molecular Formula | C10H18BrN5O2S |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]amino]-N-ethylethanesulfonamide |
| SMILES | CCNc1ncnc(NCCS(=O)(=O)NCC)c1Br |
| InChI | InChI=1S/C10H18BrN5O2S/c1-3-12-9-8(11)10(15-7-14-9)13-5-6-19(17,18)16-4-2/h7,16H,3-6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | YAJXNGKISLRNFE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |