C11H21N5O3S — CID 106343448
N-ethyl-2-[[6-(ethylamino)-5-methoxypyrimidin-4-yl]amino]ethanesulfonamide (PubChem CID 106343448) has the molecular formula C11H21N5O3S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-ethyl-2-[[6-(ethylamino)-5-methoxypyrimidin-4-yl]amino]ethanesulfonamide.
| Compound Name | N-ethyl-2-[[6-(ethylamino)-5-methoxypyrimidin-4-yl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 106343448 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-ethyl-2-[[6-(ethylamino)-5-methoxypyrimidin-4-yl]amino]ethanesulfonamide |
| SMILES | CCNc1ncnc(NCCS(=O)(=O)NCC)c1OC |
| InChI | InChI=1S/C11H21N5O3S/c1-4-12-10-9(19-3)11(15-8-14-10)13-6-7-20(17,18)16-5-2/h8,16H,4-7H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | APNYUWWPTYEACL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |