C12H23N5O3S — CID 106332310
N-[3-[[5-methoxy-6-(propylamino)pyrimidin-4-yl]amino]propyl]methanesulfonamide (PubChem CID 106332310) has the molecular formula C12H23N5O3S and a molecular weight of 317.42 g/mol. Its IUPAC name is N-[3-[[5-methoxy-6-(propylamino)pyrimidin-4-yl]amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[5-methoxy-6-(propylamino)pyrimidin-4-yl]amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106332310 |
| Molecular Formula | C12H23N5O3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[3-[[5-methoxy-6-(propylamino)pyrimidin-4-yl]amino]propyl]methanesulfonamide |
| SMILES | CCCNc1ncnc(NCCCNS(C)(=O)=O)c1OC |
| InChI | InChI=1S/C12H23N5O3S/c1-4-6-13-11-10(20-2)12(16-9-15-11)14-7-5-8-17-21(3,18)19/h9,17H,4-8H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | AVKAQUZKVIYJHA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|