C11H20N4OS — CID 114248141
4-N-(3-ethylsulfanylpropyl)-5-methoxy-6-N-methylpyrimidine-4,6-diamine (PubChem CID 114248141) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-N-(3-ethylsulfanylpropyl)-5-methoxy-6-N-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-ethylsulfanylpropyl)-5-methoxy-6-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114248141 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 4-N-(3-ethylsulfanylpropyl)-5-methoxy-6-N-methylpyrimidine-4,6-diamine |
| SMILES | CCSCCCNc1ncnc(NC)c1OC |
| InChI | InChI=1S/C11H20N4OS/c1-4-17-7-5-6-13-11-9(16-3)10(12-2)14-8-15-11/h8H,4-7H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | ZHKMMFULKQDUCI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|