C13H19N5O3S — CID 160601527
6-methoxy-7-methyl-4-[3-(sulfamoylamino)propylamino]quinazoline (PubChem CID 160601527) has the molecular formula C13H19N5O3S and a molecular weight of 325.39 g/mol. Its IUPAC name is 6-methoxy-7-methyl-4-[3-(sulfamoylamino)propylamino]quinazoline.
| Compound Name | 6-methoxy-7-methyl-4-[3-(sulfamoylamino)propylamino]quinazoline |
|---|---|
| PubChem CID | 160601527 |
| Molecular Formula | C13H19N5O3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 6-methoxy-7-methyl-4-[3-(sulfamoylamino)propylamino]quinazoline |
| SMILES | COc1cc2c(NCCCNS(N)(=O)=O)ncnc2cc1C |
| InChI | InChI=1S/C13H19N5O3S/c1-9-6-11-10(7-12(9)21-2)13(17-8-16-11)15-4-3-5-18-22(14,19)20/h6-8,18H,3-5H2,1-2H3,(H2,14,19,20)(H,15,16,17) |
| InChIKey | CVEKNTJJEQGKKG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|