C18H28N6O4S — CID 166712968
6,7-dimethoxy-4-[4-[3-(sulfamoylamino)propyl]-1,4-diazepan-1-yl]quinazoline (PubChem CID 166712968) has the molecular formula C18H28N6O4S and a molecular weight of 424.53 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[4-[3-(sulfamoylamino)propyl]-1,4-diazepan-1-yl]quinazoline.
| Compound Name | 6,7-dimethoxy-4-[4-[3-(sulfamoylamino)propyl]-1,4-diazepan-1-yl]quinazoline |
|---|---|
| PubChem CID | 166712968 |
| Molecular Formula | C18H28N6O4S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 6,7-dimethoxy-4-[4-[3-(sulfamoylamino)propyl]-1,4-diazepan-1-yl]quinazoline |
| SMILES | COc1cc2ncnc(N3CCCN(CCCNS(N)(=O)=O)CC3)c2cc1OC |
| InChI | InChI=1S/C18H28N6O4S/c1-27-16-11-14-15(12-17(16)28-2)20-13-21-18(14)24-8-4-7-23(9-10-24)6-3-5-22-29(19,25)26/h11-13,22H,3-10H2,1-2H3,(H2,19,25,26) |
| InChIKey | YFYUBPJUGRDATR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|