C23H36N6O6S — CID 166712993
tert-butyl N-[3-[4-(6,7-dimethoxyquinazolin-4-yl)-1,4-diazepan-1-yl]propylsulfamoyl]carbamate (PubChem CID 166712993) has the molecular formula C23H36N6O6S and a molecular weight of 524.64 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(6,7-dimethoxyquinazolin-4-yl)-1,4-diazepan-1-yl]propylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(6,7-dimethoxyquinazolin-4-yl)-1,4-diazepan-1-yl]propylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 166712993 |
| Molecular Formula | C23H36N6O6S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | tert-butyl N-[3-[4-(6,7-dimethoxyquinazolin-4-yl)-1,4-diazepan-1-yl]propylsulfamoyl]carbamate |
| SMILES | COc1cc2ncnc(N3CCCN(CCCNS(=O)(=O)NC(=O)OC(C)(C)C)CC3)c2cc1OC |
| InChI | InChI=1S/C23H36N6O6S/c1-23(2,3)35-22(30)27-36(31,32)26-8-6-9-28-10-7-11-29(13-12-28)21-17-14-19(33-4)20(34-5)15-18(17)24-16-25-21/h14-16,26H,6-13H2,1-5H3,(H,27,30) |
| InChIKey | UCMZGQKYOWDDLN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|