C17H26ClN5O5S — CID 166071329
2-[4-(6,7-dimethoxyquinazolin-4-yl)-1,4-diazepan-1-yl]ethylsulfamic acid;hydrochloride (PubChem CID 166071329) has the molecular formula C17H26ClN5O5S and a molecular weight of 447.95 g/mol. Its IUPAC name is 2-[4-(6,7-dimethoxyquinazolin-4-yl)-1,4-diazepan-1-yl]ethylsulfamic acid;hydrochloride.
| Compound Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)-1,4-diazepan-1-yl]ethylsulfamic acid;hydrochloride |
|---|---|
| PubChem CID | 166071329 |
| Molecular Formula | C17H26ClN5O5S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)-1,4-diazepan-1-yl]ethylsulfamic acid;hydrochloride |
| SMILES | COc1cc2ncnc(N3CCCN(CCNS(=O)(=O)O)CC3)c2cc1OC.Cl |
| InChI | InChI=1S/C17H25N5O5S.ClH/c1-26-15-10-13-14(11-16(15)27-2)18-12-19-17(13)22-6-3-5-21(8-9-22)7-4-20-28(23,24)25;/h10-12,20H,3-9H2,1-2H3,(H,23,24,25);1H |
| InChIKey | SKLZUZNRIPDMKF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|