C30H44N6O7S — CID 158781119
methane;4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]-N-(4-methylphenyl)piperazine-1-carboxamide;sulfuric acid (PubChem CID 158781119) has the molecular formula C30H44N6O7S and a molecular weight of 632.78 g/mol. Its IUPAC name is methane;4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]-N-(4-methylphenyl)piperazine-1-carboxamide;sulfuric acid.
| Compound Name | methane;4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]-N-(4-methylphenyl)piperazine-1-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 158781119 |
| Molecular Formula | C30H44N6O7S |
| Molecular Weight | 632.78 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | methane;4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]-N-(4-methylphenyl)piperazine-1-carboxamide;sulfuric acid |
| SMILES | C.COc1cc2c(N3CCN(C(=O)Nc4ccc(C)cc4)CC3)ncnc2cc1OCCCN1CCCCC1.O=S(=O)(O)O |
| InChI | InChI=1S/C29H38N6O3.CH4.H2O4S/c1-22-7-9-23(10-8-22)32-29(36)35-16-14-34(15-17-35)28-24-19-26(37-2)27(20-25(24)30-21-31-28)38-18-6-13-33-11-4-3-5-12-33;;1-5(2,3)4/h7-10,19-21H,3-6,11-18H2,1-2H3,(H,32,36);1H4;(H2,1,2,3,4) |
| InChIKey | WXHPFPMFKSMAJB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.78 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|