C19H27N5O5S — CID 163274875
tert-butyl N-[2-[1-(7-methoxyquinazolin-4-yl)azetidin-3-yl]ethylsulfamoyl]carbamate (PubChem CID 163274875) has the molecular formula C19H27N5O5S and a molecular weight of 437.52 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(7-methoxyquinazolin-4-yl)azetidin-3-yl]ethylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(7-methoxyquinazolin-4-yl)azetidin-3-yl]ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 163274875 |
| Molecular Formula | C19H27N5O5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | tert-butyl N-[2-[1-(7-methoxyquinazolin-4-yl)azetidin-3-yl]ethylsulfamoyl]carbamate |
| SMILES | COc1ccc2c(N3CC(CCNS(=O)(=O)NC(=O)OC(C)(C)C)C3)ncnc2c1 |
| InChI | InChI=1S/C19H27N5O5S/c1-19(2,3)29-18(25)23-30(26,27)22-8-7-13-10-24(11-13)17-15-6-5-14(28-4)9-16(15)20-12-21-17/h5-6,9,12-13,22H,7-8,10-11H2,1-4H3,(H,23,25) |
| InChIKey | IRRUALLJUARFSB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |