C21H24N4O6S — CID 157040016
tert-butyl N-[[4-(6-methoxy-4-oxo-3H-phthalazin-1-yl)phenyl]methylsulfamoyl]carbamate (PubChem CID 157040016) has the molecular formula C21H24N4O6S and a molecular weight of 460.51 g/mol. Its IUPAC name is tert-butyl N-[[4-(6-methoxy-4-oxo-3H-phthalazin-1-yl)phenyl]methylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[[4-(6-methoxy-4-oxo-3H-phthalazin-1-yl)phenyl]methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 157040016 |
| Molecular Formula | C21H24N4O6S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | tert-butyl N-[[4-(6-methoxy-4-oxo-3H-phthalazin-1-yl)phenyl]methylsulfamoyl]carbamate |
| SMILES | COc1ccc2c(-c3ccc(CNS(=O)(=O)NC(=O)OC(C)(C)C)cc3)n[nH]c(=O)c2c1 |
| InChI | InChI=1S/C21H24N4O6S/c1-21(2,3)31-20(27)25-32(28,29)22-12-13-5-7-14(8-6-13)18-16-10-9-15(30-4)11-17(16)19(26)24-23-18/h5-11,22H,12H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | SUTSAYKCOCMVKF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |