C17H17N3O5S — CID 166523640
6,7-dimethoxy-1-oxo-4-[4-[(sulfinoamino)methyl]phenyl]-2H-phthalazine (PubChem CID 166523640) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is 6,7-dimethoxy-1-oxo-4-[4-[(sulfinoamino)methyl]phenyl]-2H-phthalazine.
| Compound Name | 6,7-dimethoxy-1-oxo-4-[4-[(sulfinoamino)methyl]phenyl]-2H-phthalazine |
|---|---|
| PubChem CID | 166523640 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 6,7-dimethoxy-1-oxo-4-[4-[(sulfinoamino)methyl]phenyl]-2H-phthalazine |
| SMILES | COc1cc2c(-c3ccc(CNS(=O)O)cc3)n[nH]c(=O)c2cc1OC |
| InChI | InChI=1S/C17H17N3O5S/c1-24-14-7-12-13(8-15(14)25-2)17(21)20-19-16(12)11-5-3-10(4-6-11)9-18-26(22)23/h3-8,18H,9H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | JKDVDVOPONIMNE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|