C16H15N3O4S — CID 166523636
7-methoxy-1-oxo-4-[4-[(sulfinoamino)methyl]phenyl]-2H-phthalazine (PubChem CID 166523636) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is 7-methoxy-1-oxo-4-[4-[(sulfinoamino)methyl]phenyl]-2H-phthalazine.
| Compound Name | 7-methoxy-1-oxo-4-[4-[(sulfinoamino)methyl]phenyl]-2H-phthalazine |
|---|---|
| PubChem CID | 166523636 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 7-methoxy-1-oxo-4-[4-[(sulfinoamino)methyl]phenyl]-2H-phthalazine |
| SMILES | COc1ccc2c(-c3ccc(CNS(=O)O)cc3)n[nH]c(=O)c2c1 |
| InChI | InChI=1S/C16H15N3O4S/c1-23-12-6-7-13-14(8-12)16(20)19-18-15(13)11-4-2-10(3-5-11)9-17-24(21)22/h2-8,17H,9H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | HQIYOFGXWUYDJB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|