C16H17ClN4O4S — CID 157040020
7-methoxy-1-oxo-4-[4-[(sulfamoylamino)methyl]phenyl]-2H-phthalazine;hydrochloride (PubChem CID 157040020) has the molecular formula C16H17ClN4O4S and a molecular weight of 396.86 g/mol. Its IUPAC name is 7-methoxy-1-oxo-4-[4-[(sulfamoylamino)methyl]phenyl]-2H-phthalazine;hydrochloride.
| Compound Name | 7-methoxy-1-oxo-4-[4-[(sulfamoylamino)methyl]phenyl]-2H-phthalazine;hydrochloride |
|---|---|
| PubChem CID | 157040020 |
| Molecular Formula | C16H17ClN4O4S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 7-methoxy-1-oxo-4-[4-[(sulfamoylamino)methyl]phenyl]-2H-phthalazine;hydrochloride |
| SMILES | COc1ccc2c(-c3ccc(CNS(N)(=O)=O)cc3)n[nH]c(=O)c2c1.Cl |
| InChI | InChI=1S/C16H16N4O4S.ClH/c1-24-12-6-7-13-14(8-12)16(21)20-19-15(13)11-4-2-10(3-5-11)9-18-25(17,22)23;/h2-8,18H,9H2,1H3,(H,20,21)(H2,17,22,23);1H |
| InChIKey | KWIBEBRWUXOOKU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |