About 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine
2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine (PubChem CID 154630885) has the molecular formula C16H15N3O3S
and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine |
| PubChem CID | 154630885 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine |
| SMILES | COc1ccc2c(-c3ccc(CNS(=O)O)cc3)ccnc2n1 |
| InChI | InChI=1S/C16H15N3O3S/c1-22-15-7-6-14-13(8-9-17-16(14)19-15)12-4-2-11(3-5-12)10-18-23(20)21/h2-9,18H,10H2,1H3,(H,20,21) |
| InChIKey | LXYRJMKDQSICCF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine?
The IUPAC name of 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine (CID 154630885) is 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine.
What is the SMILES notation for 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine?
The canonical SMILES for 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine is COc1ccc2c(-c3ccc(CNS(=O)O)cc3)ccnc2n1.
What is the InChIKey of 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine?
The InChIKey is LXYRJMKDQSICCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3S/c1-22-15-7-6-14-13(8-9-17-16(14)19-15)12-4-2-11(3-5-12)10-18-23(20)21/h2-9,18H,10H2,1H3,(H,20,21).
What are the key properties of 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine?
2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine has a molecular weight of 329.38 g/mol, XLogP of 2.53, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-[4-[(sulfinoamino)methyl]phenyl]-1,8-naphthyridine is sourced from PubChem (CID 154630885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).