C18H16N2O3 — CID 175036962
[4-(7-methoxyquinolin-4-yl)phenyl]methyl carbamate (PubChem CID 175036962) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is [4-(7-methoxyquinolin-4-yl)phenyl]methyl carbamate.
| Compound Name | [4-(7-methoxyquinolin-4-yl)phenyl]methyl carbamate |
|---|---|
| PubChem CID | 175036962 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | [4-(7-methoxyquinolin-4-yl)phenyl]methyl carbamate |
| SMILES | COc1ccc2c(-c3ccc(COC(N)=O)cc3)ccnc2c1 |
| InChI | InChI=1S/C18H16N2O3/c1-22-14-6-7-16-15(8-9-20-17(16)10-14)13-4-2-12(3-5-13)11-23-18(19)21/h2-10H,11H2,1H3,(H2,19,21) |
| InChIKey | ZRKZAMUHVQTGNS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |