C18H19N3O4S — CID 155099810
4-[3-methoxy-4-[(sulfamoylamino)methyl]phenyl]-7-(trideuteriomethoxy)quinoline (PubChem CID 155099810) has the molecular formula C18H19N3O4S and a molecular weight of 376.45 g/mol. Its IUPAC name is 4-[3-methoxy-4-[(sulfamoylamino)methyl]phenyl]-7-(trideuteriomethoxy)quinoline.
| Compound Name | 4-[3-methoxy-4-[(sulfamoylamino)methyl]phenyl]-7-(trideuteriomethoxy)quinoline |
|---|---|
| PubChem CID | 155099810 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 4-[3-methoxy-4-[(sulfamoylamino)methyl]phenyl]-7-(trideuteriomethoxy)quinoline |
| SMILES | [2H]C([2H])([2H])Oc1ccc2c(-c3ccc(CNS(N)(=O)=O)c(OC)c3)ccnc2c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-24-14-5-6-16-15(7-8-20-17(16)10-14)12-3-4-13(18(9-12)25-2)11-21-26(19,22)23/h3-10,21H,11H2,1-2H3,(H2,19,22,23)/i1D3 |
| InChIKey | DPTGNYZFRCCQSL-FIBGUPNXSA-N |
| XLogP | 2.21 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |