C18H18N2O4S — CID 157102986
[4-(7-methoxyquinolin-4-yl)oxy-2-methylphenyl]methanesulfonamide (PubChem CID 157102986) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is [4-(7-methoxyquinolin-4-yl)oxy-2-methylphenyl]methanesulfonamide.
| Compound Name | [4-(7-methoxyquinolin-4-yl)oxy-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 157102986 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [4-(7-methoxyquinolin-4-yl)oxy-2-methylphenyl]methanesulfonamide |
| SMILES | COc1ccc2c(Oc3ccc(CS(N)(=O)=O)c(C)c3)ccnc2c1 |
| InChI | InChI=1S/C18H18N2O4S/c1-12-9-15(4-3-13(12)11-25(19,21)22)24-18-7-8-20-17-10-14(23-2)5-6-16(17)18/h3-10H,11H2,1-2H3,(H2,19,21,22) |
| InChIKey | AFZBSBXJCDMIDA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |