C20H24N2O3S — CID 168886754
1-amino-2-methylpropan-2-ol;4-(7-methoxyquinolin-4-yl)oxybenzenethiol (PubChem CID 168886754) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-amino-2-methylpropan-2-ol;4-(7-methoxyquinolin-4-yl)oxybenzenethiol.
| Compound Name | 1-amino-2-methylpropan-2-ol;4-(7-methoxyquinolin-4-yl)oxybenzenethiol |
|---|---|
| PubChem CID | 168886754 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-amino-2-methylpropan-2-ol;4-(7-methoxyquinolin-4-yl)oxybenzenethiol |
| SMILES | CC(C)(O)CN.COc1ccc2c(Oc3ccc(S)cc3)ccnc2c1 |
| InChI | InChI=1S/C16H13NO2S.C4H11NO/c1-18-12-4-7-14-15(10-12)17-9-8-16(14)19-11-2-5-13(20)6-3-11;1-4(2,6)3-5/h2-10,20H,1H3;6H,3,5H2,1-2H3 |
| InChIKey | LJPSINAKLXSITM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|