C17H18Cl2N2O3 — CID 118991674
4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;dihydrochloride (PubChem CID 118991674) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;dihydrochloride.
| Compound Name | 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;dihydrochloride |
|---|---|
| PubChem CID | 118991674 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;dihydrochloride |
| SMILES | COc1cc2nccc(Oc3ccc(N)cc3)c2cc1OC.Cl.Cl |
| InChI | InChI=1S/C17H16N2O3.2ClH/c1-20-16-9-13-14(10-17(16)21-2)19-8-7-15(13)22-12-5-3-11(18)4-6-12;;/h3-10H,18H2,1-2H3;2*1H |
| InChIKey | AHNZARFQYWBFBU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|