C19H21ClN2O3 — CID 142885243
2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;ethane (PubChem CID 142885243) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;ethane.
| Compound Name | 2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;ethane |
|---|---|
| PubChem CID | 142885243 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;ethane |
| SMILES | CC.COc1cc2nccc(Oc3ccc(N)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C17H15ClN2O3.C2H6/c1-21-16-8-11-14(9-17(16)22-2)20-6-5-15(11)23-10-3-4-13(19)12(18)7-10;1-2/h3-9H,19H2,1-2H3;1-2H3 |
| InChIKey | CSUFIOSCEANTSQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|