C13H17NO3 — CID 157066291
methane;4,6,7-trimethoxyquinoline (PubChem CID 157066291) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is methane;4,6,7-trimethoxyquinoline.
| Compound Name | methane;4,6,7-trimethoxyquinoline |
|---|---|
| PubChem CID | 157066291 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methane;4,6,7-trimethoxyquinoline |
| SMILES | C.COc1cc2nccc(OC)c2cc1OC |
| InChI | InChI=1S/C12H13NO3.CH4/c1-14-10-4-5-13-9-7-12(16-3)11(15-2)6-8(9)10;/h4-7H,1-3H3;1H4 |
| InChIKey | ABXIOOULYSIGIB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |