C16H21NO3 — CID 155219752
4,6-dimethoxy-7-pentan-3-yloxyquinoline (PubChem CID 155219752) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4,6-dimethoxy-7-pentan-3-yloxyquinoline.
| Compound Name | 4,6-dimethoxy-7-pentan-3-yloxyquinoline |
|---|---|
| PubChem CID | 155219752 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4,6-dimethoxy-7-pentan-3-yloxyquinoline |
| SMILES | CCC(CC)Oc1cc2nccc(OC)c2cc1OC |
| InChI | InChI=1S/C16H21NO3/c1-5-11(6-2)20-16-10-13-12(9-15(16)19-4)14(18-3)7-8-17-13/h7-11H,5-6H2,1-4H3 |
| InChIKey | OYOOCGGMMHMRML-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |