C18H20N2O3S — CID 165143775
4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;methanethiol (PubChem CID 165143775) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;methanethiol.
| Compound Name | 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;methanethiol |
|---|---|
| PubChem CID | 165143775 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;methanethiol |
| SMILES | COc1cc2nccc(Oc3ccc(N)cc3)c2cc1OC.CS |
| InChI | InChI=1S/C17H16N2O3.CH4S/c1-20-16-9-13-14(10-17(16)21-2)19-8-7-15(13)22-12-5-3-11(18)4-6-12;1-2/h3-10H,18H2,1-2H3;2H,1H3 |
| InChIKey | KVAVBELGXAFGTE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|