C14H10ClN3O — CID 156871767
4-[(6-chloro-1,7-naphthyridin-4-yl)oxy]aniline (PubChem CID 156871767) has the molecular formula C14H10ClN3O and a molecular weight of 271.71 g/mol. Its IUPAC name is 4-[(6-chloro-1,7-naphthyridin-4-yl)oxy]aniline.
| Compound Name | 4-[(6-chloro-1,7-naphthyridin-4-yl)oxy]aniline |
|---|---|
| PubChem CID | 156871767 |
| Molecular Formula | C14H10ClN3O |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4-[(6-chloro-1,7-naphthyridin-4-yl)oxy]aniline |
| SMILES | Nc1ccc(Oc2ccnc3cnc(Cl)cc23)cc1 |
| InChI | InChI=1S/C14H10ClN3O/c15-14-7-11-12(8-18-14)17-6-5-13(11)19-10-3-1-9(16)2-4-10/h1-8H,16H2 |
| InChIKey | ZIZKQTSGHKKOGG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|