C14H11ClN4 — CID 156871700
4-N-(6-chloro-1,7-naphthyridin-4-yl)benzene-1,4-diamine (PubChem CID 156871700) has the molecular formula C14H11ClN4 and a molecular weight of 270.72 g/mol. Its IUPAC name is 4-N-(6-chloro-1,7-naphthyridin-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(6-chloro-1,7-naphthyridin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 156871700 |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-N-(6-chloro-1,7-naphthyridin-4-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccnc3cnc(Cl)cc23)cc1 |
| InChI | InChI=1S/C14H11ClN4/c15-14-7-11-12(5-6-17-13(11)8-18-14)19-10-3-1-9(16)2-4-10/h1-8H,16H2,(H,17,19) |
| InChIKey | SDALZLXEVNTHPO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|