C26H18ClN5O2 — CID 156871819
N-[4-[(6-chloro-1,7-naphthyridin-4-yl)amino]phenyl]-2-oxo-1-phenylpyridine-3-carboxamide (PubChem CID 156871819) has the molecular formula C26H18ClN5O2 and a molecular weight of 467.92 g/mol. Its IUPAC name is N-[4-[(6-chloro-1,7-naphthyridin-4-yl)amino]phenyl]-2-oxo-1-phenylpyridine-3-carboxamide.
| Compound Name | N-[4-[(6-chloro-1,7-naphthyridin-4-yl)amino]phenyl]-2-oxo-1-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 156871819 |
| Molecular Formula | C26H18ClN5O2 |
| Molecular Weight | 467.92 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[4-[(6-chloro-1,7-naphthyridin-4-yl)amino]phenyl]-2-oxo-1-phenylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccnc3cnc(Cl)cc23)cc1)c1cccn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C26H18ClN5O2/c27-24-15-21-22(12-13-28-23(21)16-29-24)30-17-8-10-18(11-9-17)31-25(33)20-7-4-14-32(26(20)34)19-5-2-1-3-6-19/h1-16H,(H,28,30)(H,31,33) |
| InChIKey | PJDBGJXAXHOZHK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.92 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|