C26H26ClN3O3 — CID 53119327
1-[4-[(2-chlorobenzoyl)amino]phenyl]-N-cycloheptyl-2-oxopyridine-3-carboxamide (PubChem CID 53119327) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is 1-[4-[(2-chlorobenzoyl)amino]phenyl]-N-cycloheptyl-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[4-[(2-chlorobenzoyl)amino]phenyl]-N-cycloheptyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 53119327 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-[4-[(2-chlorobenzoyl)amino]phenyl]-N-cycloheptyl-2-oxopyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cccc(C(=O)NC3CCCCCC3)c2=O)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C26H26ClN3O3/c27-23-12-6-5-10-21(23)24(31)29-19-13-15-20(16-14-19)30-17-7-11-22(26(30)33)25(32)28-18-8-3-1-2-4-9-18/h5-7,10-18H,1-4,8-9H2,(H,28,32)(H,29,31) |
| InChIKey | GZUAHUNVLPFOIC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |