C25H24FN3O3 — CID 53119458
N-cyclohexyl-1-[4-[(4-fluorobenzoyl)amino]phenyl]-2-oxopyridine-3-carboxamide (PubChem CID 53119458) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is N-cyclohexyl-1-[4-[(4-fluorobenzoyl)amino]phenyl]-2-oxopyridine-3-carboxamide.
| Compound Name | N-cyclohexyl-1-[4-[(4-fluorobenzoyl)amino]phenyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 53119458 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-cyclohexyl-1-[4-[(4-fluorobenzoyl)amino]phenyl]-2-oxopyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cccc(C(=O)NC3CCCCC3)c2=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FN3O3/c26-18-10-8-17(9-11-18)23(30)27-20-12-14-21(15-13-20)29-16-4-7-22(25(29)32)24(31)28-19-5-2-1-3-6-19/h4,7-16,19H,1-3,5-6H2,(H,27,30)(H,28,31) |
| InChIKey | FLYQODXEZPIJSU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |