C29H26FN3O3 — CID 46388387
1-[4-[(4-fluorobenzoyl)amino]phenyl]-2-oxo-N-(4-phenylbutan-2-yl)pyridine-3-carboxamide (PubChem CID 46388387) has the molecular formula C29H26FN3O3 and a molecular weight of 483.54 g/mol. Its IUPAC name is 1-[4-[(4-fluorobenzoyl)amino]phenyl]-2-oxo-N-(4-phenylbutan-2-yl)pyridine-3-carboxamide.
| Compound Name | 1-[4-[(4-fluorobenzoyl)amino]phenyl]-2-oxo-N-(4-phenylbutan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46388387 |
| Molecular Formula | C29H26FN3O3 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 1-[4-[(4-fluorobenzoyl)amino]phenyl]-2-oxo-N-(4-phenylbutan-2-yl)pyridine-3-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)c1cccn(-c2ccc(NC(=O)c3ccc(F)cc3)cc2)c1=O |
| InChI | InChI=1S/C29H26FN3O3/c1-20(9-10-21-6-3-2-4-7-21)31-28(35)26-8-5-19-33(29(26)36)25-17-15-24(16-18-25)32-27(34)22-11-13-23(30)14-12-22/h2-8,11-20H,9-10H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | XBVHAMKCJWFDKL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |