C27H23N3O3 — CID 53119434
1-(4-benzamidophenyl)-N-[(4-methylphenyl)methyl]-2-oxopyridine-3-carboxamide (PubChem CID 53119434) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-(4-benzamidophenyl)-N-[(4-methylphenyl)methyl]-2-oxopyridine-3-carboxamide.
| Compound Name | 1-(4-benzamidophenyl)-N-[(4-methylphenyl)methyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 53119434 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1-(4-benzamidophenyl)-N-[(4-methylphenyl)methyl]-2-oxopyridine-3-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cccn(-c3ccc(NC(=O)c4ccccc4)cc3)c2=O)cc1 |
| InChI | InChI=1S/C27H23N3O3/c1-19-9-11-20(12-10-19)18-28-26(32)24-8-5-17-30(27(24)33)23-15-13-22(14-16-23)29-25(31)21-6-3-2-4-7-21/h2-17H,18H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | BAFUKSAUUVDEDF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |