C30H29N3O3 — CID 53119403
1-[4-[(3-methylbenzoyl)amino]phenyl]-2-oxo-N-(4-phenylbutan-2-yl)pyridine-3-carboxamide (PubChem CID 53119403) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is 1-[4-[(3-methylbenzoyl)amino]phenyl]-2-oxo-N-(4-phenylbutan-2-yl)pyridine-3-carboxamide.
| Compound Name | 1-[4-[(3-methylbenzoyl)amino]phenyl]-2-oxo-N-(4-phenylbutan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53119403 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 1-[4-[(3-methylbenzoyl)amino]phenyl]-2-oxo-N-(4-phenylbutan-2-yl)pyridine-3-carboxamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(-n3cccc(C(=O)NC(C)CCc4ccccc4)c3=O)cc2)c1 |
| InChI | InChI=1S/C30H29N3O3/c1-21-8-6-11-24(20-21)28(34)32-25-15-17-26(18-16-25)33-19-7-12-27(30(33)36)29(35)31-22(2)13-14-23-9-4-3-5-10-23/h3-12,15-20,22H,13-14H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | YWIZOQSDWORYPE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |