C29H27N3O3 — CID 46388392
1-[4-[(2-methylbenzoyl)amino]phenyl]-2-oxo-N-(3-phenylpropyl)pyridine-3-carboxamide (PubChem CID 46388392) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-[4-[(2-methylbenzoyl)amino]phenyl]-2-oxo-N-(3-phenylpropyl)pyridine-3-carboxamide.
| Compound Name | 1-[4-[(2-methylbenzoyl)amino]phenyl]-2-oxo-N-(3-phenylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46388392 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 1-[4-[(2-methylbenzoyl)amino]phenyl]-2-oxo-N-(3-phenylpropyl)pyridine-3-carboxamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(-n2cccc(C(=O)NCCCc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C29H27N3O3/c1-21-9-5-6-13-25(21)28(34)31-23-15-17-24(18-16-23)32-20-8-14-26(29(32)35)27(33)30-19-7-12-22-10-3-2-4-11-22/h2-6,8-11,13-18,20H,7,12,19H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | BURAWVHOFWQTQG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|