C14H12N4 — CID 91040633
4-N-pyridin-4-ylquinoline-4,6-diamine (PubChem CID 91040633) has the molecular formula C14H12N4 and a molecular weight of 236.28 g/mol. Its IUPAC name is 4-N-pyridin-4-ylquinoline-4,6-diamine.
| Compound Name | 4-N-pyridin-4-ylquinoline-4,6-diamine |
|---|---|
| PubChem CID | 91040633 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 4-N-pyridin-4-ylquinoline-4,6-diamine |
| SMILES | Nc1ccc2nccc(Nc3ccncc3)c2c1 |
| InChI | InChI=1S/C14H12N4/c15-10-1-2-13-12(9-10)14(5-8-17-13)18-11-3-6-16-7-4-11/h1-9H,15H2,(H,16,17,18) |
| InChIKey | MROMHGGVHBQWJB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|