C11H10FN3 — CID 157044293
2-fluoro-1-N-pyridin-4-ylbenzene-1,4-diamine (PubChem CID 157044293) has the molecular formula C11H10FN3 and a molecular weight of 203.22 g/mol. Its IUPAC name is 2-fluoro-1-N-pyridin-4-ylbenzene-1,4-diamine.
| Compound Name | 2-fluoro-1-N-pyridin-4-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 157044293 |
| Molecular Formula | C11H10FN3 |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-fluoro-1-N-pyridin-4-ylbenzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccncc2)c(F)c1 |
| InChI | InChI=1S/C11H10FN3/c12-10-7-8(13)1-2-11(10)15-9-3-5-14-6-4-9/h1-7H,13H2,(H,14,15) |
| InChIKey | PNNRAICCNHKEGH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|