C12H9F3N2 — CID 29067140
1-N-(3,4-difluorophenyl)-2-fluorobenzene-1,4-diamine (PubChem CID 29067140) has the molecular formula C12H9F3N2 and a molecular weight of 238.21 g/mol. Its IUPAC name is 1-N-(3,4-difluorophenyl)-2-fluorobenzene-1,4-diamine.
| Compound Name | 1-N-(3,4-difluorophenyl)-2-fluorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 29067140 |
| Molecular Formula | C12H9F3N2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-N-(3,4-difluorophenyl)-2-fluorobenzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccc(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C12H9F3N2/c13-9-3-2-8(6-10(9)14)17-12-4-1-7(16)5-11(12)15/h1-6,17H,16H2 |
| InChIKey | MFWMGIOAVKIVFT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|