C12H10F2N2 — CID 4764057
4-N-(2,4-difluorophenyl)benzene-1,4-diamine (PubChem CID 4764057) has the molecular formula C12H10F2N2 and a molecular weight of 220.22 g/mol. Its IUPAC name is 4-N-(2,4-difluorophenyl)benzene-1,4-diamine.
| Compound Name | 4-N-(2,4-difluorophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 4764057 |
| Molecular Formula | C12H10F2N2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-N-(2,4-difluorophenyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C12H10F2N2/c13-8-1-6-12(11(14)7-8)16-10-4-2-9(15)3-5-10/h1-7,16H,15H2 |
| InChIKey | XPMXSVZEKBEYTH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|