C12H10ClFN2 — CID 29080218
4-N-(2-chloro-4-fluorophenyl)benzene-1,4-diamine (PubChem CID 29080218) has the molecular formula C12H10ClFN2 and a molecular weight of 236.68 g/mol. Its IUPAC name is 4-N-(2-chloro-4-fluorophenyl)benzene-1,4-diamine.
| Compound Name | 4-N-(2-chloro-4-fluorophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 29080218 |
| Molecular Formula | C12H10ClFN2 |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 4-N-(2-chloro-4-fluorophenyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C12H10ClFN2/c13-11-7-8(14)1-6-12(11)16-10-4-2-9(15)3-5-10/h1-7,16H,15H2 |
| InChIKey | CHYFYCUHKXKORA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|